CymitQuimica logo

CAS 1427195-09-2

:

5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1)

Description:
5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 4-position of the pyrimidine ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the fields of medicinal chemistry and agrochemicals. Its specific interactions, reactivity, and biological effects would depend on the context of its use and the presence of other functional groups or substituents in related compounds. Safety data and handling precautions should be referenced from material safety data sheets (MSDS) due to the presence of fluorinated groups, which can pose unique hazards.
Formula:C6H6F3N3·ClH
InChI:InChI=1S/C6H6F3N3.ClH/c7-6(8,9)5-4(1-10)2-11-3-12-5;/h2-3H,1,10H2;1H
InChI key:InChIKey=PMSQNCJEHALBBS-UHFFFAOYSA-N
SMILES:C(N)C=1C(C(F)(F)F)=NC=NC1.Cl
Synonyms:
  • [4-(Trifluoromethyl)pyrimidin-5-yl]methanamine hydrochloride
  • 5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.