
CAS 1427195-09-2: 5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1)
Description:5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 4-position of the pyrimidine ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the fields of medicinal chemistry and agrochemicals. Its specific interactions, reactivity, and biological effects would depend on the context of its use and the presence of other functional groups or substituents in related compounds. Safety data and handling precautions should be referenced from material safety data sheets (MSDS) due to the presence of fluorinated groups, which can pose unique hazards.
Formula:C6H6F3N3·ClH
InChI:InChI=1S/C6H6F3N3.ClH/c7-6(8,9)5-4(1-10)2-11-3-12-5;/h2-3H,1,10H2;1H
InChI key:InChIKey=PMSQNCJEHALBBS-UHFFFAOYSA-N
SMILES:Cl.FC(F)(F)C=1N=CN=CC1CN
- Synonyms:
- [4-(Trifluoromethyl)pyrimidin-5-yl]methanamine hydrochloride
- 5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [4-(Trifluoromethyl)pyrimidin-5-yl]methanamine hydrochloride REF: 54-PC106269CAS: 1427195-09-2 | - - - | 1,599.00 €~4,292.00 € | Thu 27 Mar 25 |
![]() | 5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride REF: 10-F737562CAS: 1427195-09-2 | 98% | - - - | Discontinued product |
![]() | C-(4-Trifluoromethyl-pyrimidin-5-yl)-methylamine hydrochloride REF: 3D-CHC19509CAS: 1427195-09-2 | Min. 95% | - - - | Discontinued product |

[4-(Trifluoromethyl)pyrimidin-5-yl]methanamine hydrochloride
Ref: 54-PC106269
1g | 4,292.00 € | ||
250mg | 1,599.00 € |

5-Pyrimidinemethanamine, 4-(trifluoromethyl)-, hydrochloride
Ref: 10-F737562
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

C-(4-Trifluoromethyl-pyrimidin-5-yl)-methylamine hydrochloride
Ref: 3D-CHC19509
500mg | Discontinued | Request information |