CAS 1427195-18-3

2-Azabicyclo[4.1.0]heptane, hydrochloride (1:1)

Description:

2-Azabicyclo[4.1.0]heptane, hydrochloride (1:1) is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring containing a nitrogen atom. This compound is a derivative of bicyclic amines and is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically enhances its solubility in water and stability. As a bicyclic amine, it may exhibit properties such as basicity due to the presence of the nitrogen atom, which can participate in protonation. The compound's structure allows for various stereochemical configurations, which can influence its biological activity. Additionally, its potential interactions with biological targets make it of interest in drug design and development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₆H₁₁N·ClH

InChI: InChI=1S/C6H11N.ClH/c1-2-5-4-6(5)7-3-1;/h5-7H,1-4H2;1H

InChI key: InChIKey=UWKFPPQRRMISKQ-UHFFFAOYSA-N

SMILES: C12C(C1)NCCC2.Cl

Synonyms:

• 2-Azabicyclo[4.1.0]heptane, hydrochloride (1:1)
• 2-Azabicyclo[4.1.0]heptane hydrochloride

2-azabicyclo[4.1.0]heptane hydrochloride

CAS: 1427195-18-3

Formula: C₆H₁₂ClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 133.6192

Ref: IN-DA009K2B

2-Azabicyclo[4.1.0]heptane hydrochloride

CAS: 1427195-18-3

Formula: C₆H₁₂ClN

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 133.62

Ref: 10-F463678

2-Aza-bicyclo[4.1.0]heptane hydrochloride

CAS: 1427195-18-3

Versatile small molecule scaffold

Formula: C₆H₁₁N·HCl

Purity: Min. 95%

Molecular weight: 133.62 g/mol

Ref: 3D-CHC19518