CAS 1427195-27-4

Pyridine, 3-bromo-5-hydrazinyl-, hydrochloride (1:2)

Description:

Pyridine, 3-bromo-5-hydrazinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position and a hydrazinyl group at the 5-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, making it useful in various chemical reactions. The hydrazinyl group can participate in nucleophilic reactions, while the bromine atom can serve as a leaving group in substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. However, specific safety and handling precautions should be observed due to the potential toxicity associated with hydrazine derivatives. Overall, its structural features and functional groups make it a versatile compound in chemical synthesis and research applications.

Formula: C₅H₆BrN₃·2ClH

InChI: InChI=1S/C5H6BrN3.2ClH/c6-4-1-5(9-7)3-8-2-4;;/h1-3,9H,7H2;2*1H

InChI key: InChIKey=NAUDFVMHVHOJLR-UHFFFAOYSA-N

SMILES: N(N)C=1C=C(Br)C=NC1.Cl

Synonyms:

• Pyridine, 3-bromo-5-hydrazinyl-, hydrochloride (1:2)

3-Bromo-5-hydrazinylpyridine dihydrochloride

CAS: 1427195-27-4

3-Bromo-5-hydrazinylpyridine dihydrochloride

Purity: 98%

Molecular weight: 260.95g/mol

Ref: 54-OR79143

3-Bromo-5-hydrazinylpyridine dihydrochloride

CAS: 1427195-27-4

Purity: 98%

Molecular weight: 260.9400024

Ref: 10-F639677

(5-Bromo-pyridin-3-yl)-hydrazine dihydrochloride

CAS: 1427195-27-4

Versatile small molecule scaffold

Formula: C₅H₈BrCl₂N₃

Purity: Min. 95%

Molecular weight: 260.95 g/mol

Ref: 3D-CHC19527