CAS 1427195-39-8

5-Pyrimidinemethanamine, 4-(1,1-difluoroethyl)-, hydrochloride (1:1)

Description:

5-Pyrimidinemethanamine, 4-(1,1-difluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of the difluoroethyl group indicates that the compound has two fluorine atoms attached to a carbon chain, which can significantly influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as basicity due to the amine functional group, and it could potentially interact with biological targets, making it of interest in medicinal chemistry. Its specific applications and effects would depend on its interaction with biological systems, which could include roles in drug development or as a research chemical. Safety and handling considerations are essential, particularly due to the presence of fluorine, which can impart unique toxicological properties.

Formula: C₇H₉F₂N₃·ClH

InChI: InChI=1S/C7H9F2N3.ClH/c1-7(8,9)6-5(2-10)3-11-4-12-6;/h3-4H,2,10H2,1H3;1H

InChI key: InChIKey=KJHVZDPPUPEDSM-UHFFFAOYSA-N

SMILES: C(N)C=1C(C(C)(F)F)=NC=NC1.Cl

Synonyms:

• (4-(1,1-Difluoroethyl)pyrimidin-5-yl)methanamine hydrochloride
• 5-Pyrimidinemethanamine, 4-(1,1-difluoroethyl)-, hydrochloride (1:1)

[4-(1,1-Difluoroethyl)pyrimidin-5-yl]methanamine hydrochloride

CAS: 1427195-39-8

[4-(1,1-Difluoroethyl)pyrimidin-5-yl]methanamine hydrochloride

Molecular weight: 209.62421g/mol

Ref: 54-PC106260