CAS 14272-47-0
:3-ETHYLHEPTANOIC ACID
Description:
3-Ethylheptanoic acid is a branched-chain fatty acid characterized by its seven-carbon backbone with an ethyl group attached to the third carbon. This compound is a colorless to pale yellow liquid at room temperature and has a distinct fatty odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The molecular formula of 3-ethylheptanoic acid is C9H18O2, indicating the presence of a carboxylic acid functional group, which imparts acidic properties. This substance is primarily used in the synthesis of various esters and as an intermediate in the production of surfactants, lubricants, and plasticizers. Its branched structure contributes to its unique physical and chemical properties, making it valuable in industrial applications. Additionally, 3-ethylheptanoic acid may exhibit low toxicity, but safety precautions should be taken when handling it, as with all chemical substances.
Formula:C9H18O2
InChI:InChI=1/C9H18O2/c1-3-5-6-8(4-2)7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11)
SMILES:CCCCC(CC)CC(=O)O
Synonyms:- 3-Ethylheptanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-ethylheptanoic acid
CAS:<p>3-Ethylheptanoic acid is used in the analysis of sedimentation and viscosity. It was found to be a good antioxidant based on its ability to inhibit the oxidation of linoleic acid, which is an essential fatty acid. 3-Ethylheptanoic acid has also been shown to have chemopreventive properties in mice with skin cancer. This compound is thought to have anti-inflammatory properties because it inhibits the production of prostaglandins by inhibiting cyclooxygenase activity. Furthermore, 3-ethylheptanoic acid has been used as a chemical intermediate for synthesizing other compounds such as amines, alcohols, and phenolic compounds.</p>Formula:C9H18O2Purity:Min. 95%Molecular weight:158.23 g/mol
