CAS 14273-88-2
:Pentanoic acid, 5-iodo-, methyl ester
Description:
Pentanoic acid, 5-iodo-, methyl ester, also known as methyl 5-iodopentanoate, is an organic compound characterized by its ester functional group derived from pentanoic acid and iodine substitution at the fifth carbon. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The presence of the iodine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in organic chemistry for the introduction of iodine into other compounds. This compound is soluble in organic solvents and exhibits moderate polarity due to the ester group. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Safety data indicates that, like many iodinated compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage and handling protocols are essential to mitigate risks associated with exposure.
Formula:C6H11IO2
InChI:InChI=1S/C6H11IO2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3
InChI key:InChIKey=LTRHTLMOPUYPRM-UHFFFAOYSA-N
SMILES:C(CCCCI)(OC)=O
Synonyms:- 5-Iodopentanoic acid methyl ester
- Methyl 5-iodovalerate
- NSC 339626
- Pentanoic Acid, 5-Iodo-, Methyl Ester
- Valeric acid, 5-iodo-, methyl ester
- Methyl 5-iodopentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
