CAS 14273-90-6
:Methyl 6-bromohexanoate
Description:
Methyl 6-bromohexanoate is an organic compound characterized by its ester functional group, which is derived from hexanoic acid and methanol. It features a six-carbon chain with a bromine atom attached to the sixth carbon, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. This compound is typically a colorless to pale yellow liquid with a fruity odor, indicative of its ester nature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic alkyl chain. Methyl 6-bromohexanoate can be utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, and serves as an intermediate in various chemical processes. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C7H13BrO2
InChI:InChI=1S/C7H13BrO2/c1-10-7(9)5-3-2-4-6-8/h2-6H2,1H3
InChI key:InChIKey=KYLVAMSNNZMHSX-UHFFFAOYSA-N
SMILES:C(CCCCCBr)(OC)=O
Synonyms:- Methyl 6-bromohexanoate
- 6-Bromohexanoic acid methyl ester
- Methyl 6-bromocaproate
- Hexanoic acid, 6-bromo-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 6-Bromohexanoate
CAS:Formula:C7H13BrO2Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:209.08Methyl 6-bromohexanoate
CAS:Formula:C7H13BrO2Purity:97%Color and Shape:LiquidMolecular weight:209.0809Methyl 6-bromohexanoate
CAS:Methyl 6-bromohexanoateFormula:C7H13BrO2Purity:98%Color and Shape: colourless to light yellow liquidMolecular weight:209.08g/molMethyl 6-bromohexanoate
CAS:Formula:C7H13BrO2Purity:95.0%Color and Shape:LiquidMolecular weight:209.0836-Bromohexanoic acid methyl ester
CAS:6-Bromohexanoic acid methyl ester is a linker that can be used in the synthesis of amides. This compound is synthesized by reaction between 2-bromobutyric acid and malonic acid, followed by hydrolysis with sodium hydroxide. 6-Bromohexanoic acid methyl ester is an efficient method for the preparation of amides. It is biologically active and has been shown to have anti-inflammatory properties in biological studies.
Formula:C7H13BrO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:209.08 g/mol




