CAS 1427378-53-7

3-Furanacetamide, α-aminotetrahydro-, hydrochloride (1:1)

Description:

3-Furanacetamide, α-aminotetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which contributes to its unique reactivity and properties. This compound features an acetamide functional group, indicating the presence of an amide bond, which is known for its stability and ability to participate in hydrogen bonding. The α-aminotetrahydro component suggests that it contains a tetrahydrofuran moiety, which is a saturated cyclic ether, enhancing its solubility in polar solvents. The hydrochloride form indicates that the compound is a salt, which typically increases its stability and solubility in aqueous solutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions, including potential hydrogen bonding and dipole-dipole interactions, can influence its behavior in biological systems. Overall, 3-Furanacetamide, α-aminotetrahydro-, hydrochloride (1:1) is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₆H₁₂N₂O₂·ClH

InChI: InChI=1S/C6H12N2O2.ClH/c7-5(6(8)9)4-1-2-10-3-4;/h4-5H,1-3,7H2,(H2,8,9);1H

InChI key: InChIKey=WILGGNFHYBGKNJ-UHFFFAOYSA-N

SMILES: C(C(N)=O)(N)C1CCOC1.Cl

Synonyms:

• 3-Furanacetamide, α-aminotetrahydro-, hydrochloride (1:1)

2-Amino-2-(oxolan-3-yl)acetamide hydrochloride

CAS: 1427378-53-7

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 180.63 g/mol

Ref: 3D-CHC37853