CAS 1427378-62-8

2H,5H-Pyrano[4,3-b]-1,4-oxazine, hexahydro-2-methyl-, hydrochloride (1:1)

Description:

2H,5H-Pyrano[4,3-b]-1,4-oxazine, hexahydro-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a pyran and oxazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The hexahydro configuration indicates that the compound is fully saturated, contributing to its stability and possibly influencing its reactivity. The methyl group at the 2-position may affect its steric and electronic properties, potentially enhancing its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, facilitating its use in pharmaceutical applications. The compound's specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound may be of interest in medicinal chemistry and pharmacology due to its structural features and potential bioactivity.

Formula: C₈H₁₅NO₂·ClH

InChI: InChI=1S/C8H15NO2.ClH/c1-6-4-9-7-5-10-3-2-8(7)11-6;/h6-9H,2-5H2,1H3;1H

InChI key: InChIKey=ZWFRTEYTZMEQQR-UHFFFAOYSA-N

SMILES: CC1OC2C(NC1)COCC2.Cl

Synonyms:

• 2H,5H-Pyrano[4,3-b]-1,4-oxazine, hexahydro-2-methyl-, hydrochloride (1:1)

2-Methyl-octahydropyrano[4,3-b]morpholine hydrochloride

CAS: 1427378-62-8

Versatile small molecule scaffold

Formula: C₈H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 193.67 g/mol

Ref: 3D-CHC37862