CAS 1427378-68-4

N-Ethyl-6-fluoro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:

N-Ethyl-6-fluoro-1,2,3,4-tetrahydro-1-naphthalenamine is a chemical compound characterized by its unique structure, which includes a naphthalene ring system that has been partially saturated and substituted with an ethyl group and a fluorine atom. This compound belongs to the class of amines, specifically secondary amines, due to the presence of the ethyl group attached to the nitrogen atom. The fluorine substitution at the 6-position of the naphthalene ring can influence the compound's reactivity and biological activity, potentially enhancing lipophilicity and altering pharmacokinetic properties. The tetrahydro configuration indicates that the compound has four hydrogen atoms added to the naphthalene structure, resulting in a more saturated and stable form. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which the compound is analyzed.

Formula: C₁₂H₁₆FN

InChI: InChI=1S/C12H16FN/c1-2-14-12-5-3-4-9-8-10(13)6-7-11(9)12/h6-8,12,14H,2-5H2,1H3

InChI key: InChIKey=GPRQPHLZBVMCCO-UHFFFAOYSA-N

SMILES: N(CC)C1C=2C(=CC(F)=CC2)CCC1

Synonyms:

• N-Ethyl-6-fluoro-1,2,3,4-tetrahydro-1-naphthalenamine
• 1-Naphthalenamine, N-ethyl-6-fluoro-1,2,3,4-tetrahydro-