CAS 1427378-77-5

1H-1,2,4-Triazole-5-ethanamine, 1-methyl-3-phenyl-, hydrochloride (1:2)

Description:

1H-1,2,4-Triazole-5-ethanamine, 1-methyl-3-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethylamine side chain and a phenyl group, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the methyl and phenyl groups suggests that this compound may exhibit interesting electronic and steric properties, which could influence its reactivity and interaction with biological targets. As a triazole derivative, it may also possess antifungal or antimicrobial properties, common among compounds in this class. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₁₁H₁₄N₄·2ClH

InChI: InChI=1S/C11H14N4.2ClH/c1-15-10(7-8-12)13-11(14-15)9-5-3-2-4-6-9;;/h2-6H,7-8,12H2,1H3;2*1H

InChI key: InChIKey=JJLAZAAKEQGJHK-UHFFFAOYSA-N

SMILES: C(CN)C1=NC(=NN1C)C2=CC=CC=C2.Cl

Synonyms:

• 1H-1,2,4-Triazole-5-ethanamine, 1-methyl-3-phenyl-, hydrochloride (1:2)

2-(1-Methyl-3-phenyl-1H-1,2,4-triazol-5-yl)ethan-1-amine dihydrochloride

CAS: 1427378-77-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆Cl₂N₄

Purity: Min. 95%

Molecular weight: 275.17 g/mol

Ref: 3D-CHC37877