CAS 1427378-95-7

2-(3-Chloro-2-pyridinyl)-4-thiazolecarboxylic acid

Description:

2-(3-Chloro-2-pyridinyl)-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a chlorine atom and a thiazole ring containing a carboxylic acid functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of both the carboxylic acid and halogen functionalities. The chlorine atom may influence its biological activity and lipophilicity, while the thiazole moiety can contribute to its potential as a pharmacophore in medicinal chemistry. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Its applications may extend to fields such as agrochemicals or pharmaceuticals, where it could serve as an intermediate or active ingredient. As with many heterocycles, the compound's reactivity and interactions with biological systems can be of significant interest in research and development.

Formula: C₉H₅ClN₂O₂S

InChI: InChI=1S/C9H5ClN2O2S/c10-5-2-1-3-11-7(5)8-12-6(4-15-8)9(13)14/h1-4H,(H,13,14)

InChI key: InChIKey=PFQCDHYYSGJDBQ-UHFFFAOYSA-N

SMILES: ClC1=C(N=CC=C1)C2=NC(C(O)=O)=CS2

Synonyms:

• 4-Thiazolecarboxylic acid, 2-(3-chloro-2-pyridinyl)-
• 2-(3-Chloro-2-pyridinyl)-4-thiazolecarboxylic acid

2-(3-Chloropyridin-2-yl)-1,3-thiazole-4-carboxylic acid

CAS: 1427378-95-7

Versatile small molecule scaffold

Formula: C₉H₅ClN₂O₂S

Purity: Min. 95%

Molecular weight: 240.67 g/mol

Ref: 3D-CHC37895