CAS 1427378-96-8

3-Pyrrolidinol, 3-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

3-Pyrrolidinol, 3-[(3-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring, influencing the compound's reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential central nervous system agent, given the structural features common to many psychoactive substances. Its hydrochloride form suggests it may be used in various formulations, including those for medicinal purposes. Safety and handling precautions are essential, as with any chemical, due to potential toxicity or reactivity. Overall, the characteristics of this compound make it of interest in both synthetic chemistry and pharmacology, although specific applications would depend on further research and testing.

Formula: C₁₁H₁₄ClNO·ClH

InChI: InChI=1S/C11H14ClNO.ClH/c12-10-3-1-2-9(6-10)7-11(14)4-5-13-8-11;/h1-3,6,13-14H,4-5,7-8H2;1H

InChI key: InChIKey=KQMZIIUTPQWUHU-UHFFFAOYSA-N

SMILES: C(C1(O)CCNC1)C2=CC(Cl)=CC=C2.Cl

Synonyms:

• 3-Pyrrolidinol, 3-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

3-[(3-Chlorophenyl)methyl]pyrrolidin-3-ol hydrochloride

CAS: 1427378-96-8

Versatile small molecule scaffold

Formula: C₁₁H₁₅Cl₂NO

Purity: Min. 95%

Molecular weight: 248.15 g/mol

Ref: 3D-CHC37896