CAS 1427378-97-9

3-Pyrrolidinamine, 1-[[3-(4-methylphenyl)-5-isoxazolyl]methyl]-, hydrochloride (1:2)

Description:

3-Pyrrolidinamine, 1-[[3-(4-methylphenyl)-5-isoxazolyl]methyl]-, hydrochloride (1:2), identified by CAS number 1427378-97-9, is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and an isoxazole moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is beneficial for various applications, including pharmaceutical formulations. The presence of the 4-methylphenyl group contributes to its hydrophobic characteristics, potentially influencing its biological activity and interaction with biological targets. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed, given the potential for biological activity and the need for proper characterization in research and industrial applications.

Formula: C₁₅H₁₉N₃O·2ClH

InChI: InChI=1S/C15H19N3O.2ClH/c1-11-2-4-12(5-3-11)15-8-14(19-17-15)10-18-7-6-13(16)9-18;;/h2-5,8,13H,6-7,9-10,16H2,1H3;2*1H

InChI key: InChIKey=BCDOMQSJLPBHDU-UHFFFAOYSA-N

SMILES: C(C1=CC(=NO1)C2=CC=C(C)C=C2)N3CC(N)CC3.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-[[3-(4-methylphenyl)-5-isoxazolyl]methyl]-, hydrochloride (1:2)

1-{[3-(4-Methylphenyl)-1,2-oxazol-5-yl]methyl}pyrrolidin-3-amine dihydrochloride

CAS: 1427378-97-9

Versatile small molecule scaffold

Formula: C₁₅H₂₁Cl₂N₃O

Purity: Min. 95%

Molecular weight: 330.2 g/mol

Ref: 3D-CHC37897