CAS 1427379-01-8

1,3-Propanediol, 2-(aminomethyl)-, hydrochloride (1:1)

Description:

1,3-Propanediol, 2-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a propanediol backbone with an aminomethyl group and a hydrochloride salt form. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride group, which enhances its polarity. It is often used in various applications, including pharmaceuticals and as a building block in organic synthesis. The presence of the amino group suggests potential reactivity, allowing it to participate in further chemical reactions, such as amine-based coupling or condensation reactions. Additionally, the hydrochloride form can influence the compound's stability and bioavailability in biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique functional groups contribute to its utility in diverse chemical and industrial applications.

Formula: C₄H₁₁NO₂·ClH

InChI: InChI=1S/C4H11NO2.ClH/c5-1-4(2-6)3-7;/h4,6-7H,1-3,5H2;1H

InChI key: InChIKey=YJJPPSTZJUVIKP-UHFFFAOYSA-N

SMILES: C(CN)(CO)CO.Cl

Synonyms:

• 1,3-Propanediol, 2-(aminomethyl)-, hydrochloride (1:1)
• 2-(Aminomethyl)propane-1,3-diol hydrochloride

2-(Aminomethyl)propane-1,3-diol hydrochloride

CAS: 1427379-01-8

Versatile small molecule scaffold

Formula: C₄H₁₂ClNO₂

Purity: Min. 95%

Molecular weight: 141.6 g/mol

Ref: 3D-CHC37901