CAS 1427379-10-9

9-Methyl-6-azaspiro[3.5]nonane

Description:

9-Methyl-6-azaspiro[3.5]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom incorporated into a bicyclic framework. The presence of the methyl group at the 9-position contributes to its overall molecular complexity and can influence its chemical reactivity and physical properties. This compound is part of a class of molecules known for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The azaspiro structure may impart specific conformational characteristics that can affect binding affinity and selectivity. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many nitrogen-containing heterocycles, 9-Methyl-6-azaspiro[3.5]nonane may exhibit interesting properties such as basicity and the ability to form hydrogen bonds, which are crucial for its interactions in biological systems. Further studies would be necessary to fully elucidate its potential applications and behavior in various chemical contexts.

Formula: C₉H₁₇N

InChI: InChI=1S/C9H17N/c1-8-3-6-10-7-9(8)4-2-5-9/h8,10H,2-7H2,1H3

InChI key: InChIKey=RBFKADPKAMWGKG-UHFFFAOYSA-N

SMILES: CC1C2(CNCC1)CCC2

Synonyms:

• 6-Azaspiro[3.5]nonane, 9-methyl-
• 9-Methyl-6-azaspiro[3.5]nonane

9-Methyl-6-azaspiro[3.5]nonane

CAS: 1427379-10-9

Versatile small molecule scaffold

Formula: C₉H₁₇N

Purity: Min. 95%

Molecular weight: 139.24 g/mol

Ref: 3D-CHC37910