CAS 1427379-16-5

2-Azetidinone, 1-amino-, hydrochloride (1:1)

Description:

2-Azetidinone, 1-amino-, hydrochloride (1:1) is a chemical compound characterized by its azetidinone structure, which features a four-membered cyclic amide. This compound typically exhibits properties associated with both amines and lactams, making it of interest in various chemical and pharmaceutical applications. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in water and stability. The presence of the amino group suggests potential reactivity, allowing for further derivatization or interaction with other chemical entities. This compound may be utilized in medicinal chemistry, particularly in the development of new therapeutic agents, due to its structural features that can influence biological activity. Additionally, its unique ring structure may contribute to specific pharmacokinetic properties. As with many chemical substances, safety data and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₃H₆N₂O·ClH

InChI: InChI=1S/C3H6N2O.ClH/c4-5-2-1-3(5)6;/h1-2,4H2;1H

InChI key: InChIKey=JJIPLFFRHAPYTN-UHFFFAOYSA-N

SMILES: O=C1N(N)CC1.Cl

Synonyms:

• 2-Azetidinone, 1-amino-, hydrochloride (1:1)

1-Aminoazetidin-2-one hydrochloride

CAS: 1427379-16-5

Versatile small molecule scaffold

Formula: C₃H₇ClN₂O

Purity: Min. 95%

Molecular weight: 122.55 g/mol

Ref: 3D-CHC37916