CAS 1427379-22-3

6-Amino-7-[(3-hydroxybutyl)amino]-4(3H)-quinazolinone

Description:

6-Amino-7-[(3-hydroxybutyl)amino]-4(3H)-quinazolinone is a chemical compound characterized by its quinazolinone core structure, which is a bicyclic compound containing both a benzene and a pyrimidine ring. This substance features an amino group at the 6-position and a hydroxybutylamino side chain at the 7-position, contributing to its potential biological activity. The presence of the amino and hydroxyl functional groups suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its CAS number, 1427379-22-3, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses. As with many quinazolinone derivatives, it may exhibit a range of pharmacological activities, including anti-inflammatory or anticancer properties, although specific biological effects would require further investigation through experimental studies.

Formula: C₁₂H₁₆N₄O₂

InChI: InChI=1S/C12H16N4O2/c1-7(17)2-3-14-11-5-10-8(4-9(11)13)12(18)16-6-15-10/h4-7,14,17H,2-3,13H2,1H3,(H,15,16,18)

InChI key: InChIKey=JJBANPIKEUTMGO-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(NCCC(C)O)=C(N)C2)NC=N1

6-Amino-7-[(3-hydroxybutyl)amino]-3,4-dihydroquinazolin-4-one

CAS: 1427379-22-3

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₄O₂

Purity: Min. 95%

Molecular weight: 248.3 g/mol

Ref: 3D-CHC37922