CAS 1427379-41-6

Pyridine, 4-(3,4-dimethoxyphenyl)-1,2,3,6-tetrahydro-, hydrochloride (1:1)

Description:

Pyridine, 4-(3,4-dimethoxyphenyl)-1,2,3,6-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The compound features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated or partially saturated structure. The presence of the 3,4-dimethoxyphenyl group suggests that it has two methoxy (-OCH3) substituents on a phenyl ring, contributing to its overall hydrophobic character and potential for various interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed due to the potential toxicity associated with nitrogen-containing heterocycles.

Formula: C₁₃H₁₇NO₂·ClH

InChI: InChI=1S/C13H17NO2.ClH/c1-15-12-4-3-11(9-13(12)16-2)10-5-7-14-8-6-10;/h3-5,9,14H,6-8H2,1-2H3;1H

InChI key: InChIKey=VCGRXPMMMNLEKJ-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1OC)C=2CCNCC2.Cl

Synonyms:

• Pyridine, 4-(3,4-dimethoxyphenyl)-1,2,3,6-tetrahydro-, hydrochloride (1:1)

4-(3,4-Dimethoxyphenyl)-1,2,3,6-tetrahydropyridine hydrochloride

CAS: 1427379-41-6

Versatile small molecule scaffold

Formula: C₁₃H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 255.74 g/mol

Ref: 3D-CHC37941