CAS 1427379-83-6

3-Pyrrolidinecarboxylic acid, 1-(2-aminoethyl)-5-oxo-, hydrochloride (1:1)

Description:

3-Pyrrolidinecarboxylic acid, 1-(2-aminoethyl)-5-oxo-, hydrochloride (1:1), with CAS number 1427379-83-6, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and an oxo group, contributing to its acidic properties and potential reactivity. The presence of the aminoethyl side chain indicates that it may participate in various biological interactions, possibly acting as a neurotransmitter or influencing metabolic pathways. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit specific stereochemistry, which can influence its biological activity and interactions with receptors or enzymes. Overall, its unique structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological or metabolic disorders. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its applications.

Formula: C₇H₁₂N₂O₃·ClH

InChI: InChI=1S/C7H12N2O3.ClH/c8-1-2-9-4-5(7(11)12)3-6(9)10;/h5H,1-4,8H2,(H,11,12);1H

InChI key: InChIKey=NAKPVWQCVCYTKI-UHFFFAOYSA-N

SMILES: C(CN)N1CC(C(O)=O)CC1=O.Cl

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-(2-aminoethyl)-5-oxo-, hydrochloride (1:1)

1-(2-Aminoethyl)-5-oxopyrrolidine-3-carboxylic acid hydrochloride

CAS: 1427379-83-6

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₂O₃

Purity: Min. 95%

Molecular weight: 208.64 g/mol

Ref: 3D-CHC37983