CAS 1427379-90-5

Cyclopropanamine, 1-cyclobutyl-, hydrochloride (1:1)

Description:

Cyclopropanamine, 1-cyclobutyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropane and a cyclobutane moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the amine functional group suggests potential basicity and reactivity, allowing for interactions with acids and other electrophiles. Its molecular structure may impart specific steric and electronic properties, influencing its behavior in biological systems or chemical reactions. As a hydrochloride, it is likely to exhibit stability under standard conditions, although it may be sensitive to moisture and air. The compound's characteristics, including its melting point, boiling point, and spectral properties, would be essential for identifying and utilizing it in research or industrial applications. Overall, cyclopropanamine, 1-cyclobutyl-, hydrochloride (1:1) represents a versatile building block in the field of organic chemistry.

Formula: C₇H₁₃N·ClH

InChI: InChI=1S/C7H13N.ClH/c8-7(4-5-7)6-2-1-3-6;/h6H,1-5,8H2;1H

InChI key: InChIKey=RNKWYSGBHBVOLC-UHFFFAOYSA-N

SMILES: NC1(CC1)C2CCC2.Cl

Synonyms:

• Cyclopropanamine, 1-cyclobutyl-, hydrochloride (1:1)

1-Cyclobutylcyclopropan-1-amine hydrochloride

CAS: 1427379-90-5

Versatile small molecule scaffold

Formula: C₇H₁₄ClN

Purity: Min. 95%

Molecular weight: 147.64 g/mol

Ref: 3D-CHC37990