CAS 1427380-06-0

Pyridazine, 3-(chloromethyl)-6-phenoxy-, hydrochloride (1:1)

Description:

Pyridazine, 3-(chloromethyl)-6-phenoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chloromethyl group at the 3-position and a phenoxy group at the 6-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical processes. The compound may exhibit specific biological activities, making it of interest for medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Safety and handling precautions are essential, as with many chlorinated compounds, due to potential toxicity and environmental impact. Overall, this compound represents a class of heterocyclic compounds that are valuable in synthetic chemistry and drug development.

Formula: C₁₁H₉ClN₂O·ClH

InChI: InChI=1S/C11H9ClN2O.ClH/c12-8-9-6-7-11(14-13-9)15-10-4-2-1-3-5-10;/h1-7H,8H2;1H

InChI key: InChIKey=BKVSPRPAHBTFLX-UHFFFAOYSA-N

SMILES: O(C1=CC=C(CCl)N=N1)C2=CC=CC=C2.Cl

Synonyms:

• Pyridazine, 3-(chloromethyl)-6-phenoxy-, hydrochloride (1:1)

3-(Chloromethyl)-6-phenoxypyridazine hydrochloride

CAS: 1427380-06-0

Versatile small molecule scaffold

Formula: C₁₁H₁₀Cl₂N₂O

Purity: Min. 95%

Molecular weight: 257.11 g/mol

Ref: 3D-CHC38006