CAS 1427380-54-8

4-Pyridinamine, 2-(methylsulfonyl)-, hydrochloride (1:1)

Description:

4-Pyridinamine, 2-(methylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the methylsulfonyl group indicates that it has a sulfonyl functional group (-SO2-) attached to a methyl group, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its stability and solubility in aqueous solutions. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or active ingredient, although specific applications would depend on its pharmacological properties. The hydrochloride form often improves the compound's bioavailability and facilitates its handling in laboratory and industrial settings. Safety data sheets should be consulted for handling precautions, as compounds with amine and sulfonyl groups can have specific toxicity and reactivity profiles. Overall, 4-Pyridinamine, 2-(methylsulfonyl)-, hydrochloride is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₆H₈N₂O₂S·ClH

InChI: InChI=1S/C6H8N2O2S.ClH/c1-11(9,10)6-4-5(7)2-3-8-6;/h2-4H,1H3,(H2,7,8);1H

InChI key: InChIKey=BOLUXGZIDYUGPP-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC(N)=CC=N1.Cl

Synonyms:

• 4-Pyridinamine, 2-(methylsulfonyl)-, hydrochloride (1:1)
• 2-Methanesulfonylpyridin-4-amine hydrochloride

2-Methanesulfonylpyridin-4-amine hydrochloride

CAS: 1427380-54-8

Versatile small molecule scaffold

Formula: C₆H₉ClN₂O₂S

Purity: Min. 95%

Molecular weight: 208.67 g/mol

Ref: 3D-CHC38054