CAS 1427380-59-3

2(1H)-Quinoxalinone, 1-(2-aminoethyl)-3-methyl-, hydrochloride (1:1)

Description:

2(1H)-Quinoxalinone, 1-(2-aminoethyl)-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoxalinone core structure, which is a bicyclic compound containing a fused benzene and pyridine ring. This specific derivative features an aminoethyl side chain and a methyl group at the 3-position of the quinoxalinone ring, contributing to its unique properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential for biological activity, possibly influencing interactions with biological targets. This compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities would require further investigation. Its CAS number, 1427380-59-3, allows for precise identification in chemical databases, facilitating research and development in related fields.

Formula: C₁₁H₁₃N₃O·ClH

InChI: InChI=1S/C11H13N3O.ClH/c1-8-11(15)14(7-6-12)10-5-3-2-4-9(10)13-8;/h2-5H,6-7,12H2,1H3;1H

InChI key: InChIKey=RLTYWBWLZRNMPK-UHFFFAOYSA-N

SMILES: C(CN)N1C=2C(N=C(C)C1=O)=CC=CC2.Cl

Synonyms:

• 2(1H)-Quinoxalinone, 1-(2-aminoethyl)-3-methyl-, hydrochloride (1:1)

1-(2-Aminoethyl)-3-methyl-1,2-dihydroquinoxalin-2-one hydrochloride

CAS: 1427380-59-3

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClN₃O

Purity: Min. 95%

Molecular weight: 239.7 g/mol

Ref: 3D-CHC38059