CAS 1427380-84-4

1H-Imidazole, 2-(2-pyrrolidinyl)-, hydrochloride (1:2)

Description:

1H-Imidazole, 2-(2-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a pyrrolidine moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the imidazole and pyrrolidine groups suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, which can be exploited in synthetic chemistry or drug development. Overall, this compound's unique structural features and solubility profile make it a candidate for further research in therapeutic applications.

Formula: C₇H₁₁N₃·2ClH

InChI: InChI=1S/C7H11N3.2ClH/c1-2-6(8-3-1)7-9-4-5-10-7;;/h4-6,8H,1-3H2,(H,9,10);2*1H

InChI key: InChIKey=YKIIUYRGTMSSEJ-UHFFFAOYSA-N

SMILES: C1(CCCN1)C=2NC=CN2.Cl

Synonyms:

• 1H-Imidazole, 2-(2-pyrrolidinyl)-, hydrochloride (1:2)

2-(Pyrrolidin-2-yl)-1H-imidazole dihydrochloride

CAS: 1427380-84-4

Versatile small molecule scaffold

Formula: C₇H₁₃Cl₂N₃

Purity: Min. 95%

Molecular weight: 210.1 g/mol

Ref: 3D-CHC38084