CAS 1427380-99-1

1,4-Dimethyl 1-amino-1,4-cyclohexanedicarboxylate

Description:

1,4-Dimethyl 1-amino-1,4-cyclohexanedicarboxylate is an organic compound characterized by its structure, which includes a cyclohexane ring with two carboxylate groups and an amino group, along with two methyl substituents. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential basicity due to the amino group and acidity from the carboxylate groups. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential reactivity and ability to form derivatives. Its synthesis and applications would depend on the specific functionalization of the cyclohexane framework, which can influence its chemical behavior and interactions. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines.

Formula: C₁₀H₁₇NO₄

InChI: InChI=1S/C10H17NO4/c1-14-8(12)7-3-5-10(11,6-4-7)9(13)15-2/h7H,3-6,11H2,1-2H3

InChI key: InChIKey=FVVFIQGZEMPZLA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(N)CCC(C(OC)=O)CC1

Synonyms:

• 1,4-Cyclohexanedicarboxylic acid, 1-amino-, 1,4-dimethyl ester
• 1,4-Dimethyl 1-amino-1,4-cyclohexanedicarboxylate

1,4-Dimethyl 1-aminocyclohexane-1,4-dicarboxylate

CAS: 1427380-99-1

Versatile small molecule scaffold

Formula: C₁₀H₁₇NO₄

Purity: Min. 95%

Molecular weight: 215.25 g/mol

Ref: 3D-CHC38099