CymitQuimica logo

CAS 1427381-03-0

:

α-(Phenylmethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1-piperazineethanol

Description:
α-(Phenylmethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1-piperazineethanol, identified by its CAS number 1427381-03-0, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The compound is characterized by the presence of a phenylmethyl group and a trifluoromethyl-substituted phenyl group, contributing to its unique chemical properties and potential biological activity. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, which may influence the compound's pharmacokinetic profile. Additionally, the presence of the hydroxyl group (ethanol moiety) suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C21H25F3N2O
InChI:InChI=1S/C21H25F3N2O/c22-21(23,24)19-8-6-18(7-9-19)15-25-10-12-26(13-11-25)16-20(27)14-17-4-2-1-3-5-17/h1-9,20,27H,10-16H2
InChI key:InChIKey=SMNIMGQUBCGGSD-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C(F)(F)F)C=C1)N2CCN(CC(CC3=CC=CC=C3)O)CC2
Synonyms:
  • α-(Phenylmethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1-piperazineethanol
  • 1-Piperazineethanol, α-(phenylmethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-
  • 1-phenyl-3-(4-{[4-(trifluoromethyl)phenyl]methyl}piperazin-1-yl)propan-2-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.