CAS 1427381-06-3

1-Naphthalenol, 1-(aminomethyl)-1,2,3,4-tetrahydro-7-methoxy-, hydrochloride (1:1)

Description:

1-Naphthalenol, 1-(aminomethyl)-1,2,3,4-tetrahydro-7-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and a tetrahydro derivative. This compound features a hydroxyl group (-OH) and an aminomethyl group (-CH2NH2), contributing to its potential as a bioactive molecule. The presence of the methoxy group (-OCH3) enhances its solubility and may influence its pharmacological properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in medicinal chemistry and research. The compound may exhibit biological activities, potentially acting as an intermediate in the synthesis of pharmaceuticals or as a ligand in biochemical assays. Its specific interactions and effects would depend on the context of its use, including concentration and the biological system involved. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₂H₁₈ClNO₂

InChI: InChI=1S/C12H17NO2.ClH/c1-15-10-5-4-9-3-2-6-12(14,8-13)11(9)7-10;/h4-5,7,14H,2-3,6,8,13H2,1H3;1H

InChI key: InChIKey=LLOMSQDXGQQEIX-UHFFFAOYSA-N

SMILES: C(N)C1(O)C=2C(=CC=C(OC)C2)CCC1.Cl

Synonyms:

• 1-Naphthalenol, 1-(aminomethyl)-1,2,3,4-tetrahydro-7-methoxy-, hydrochloride (1:1)
• 1-(aminomethyl)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol hydrochloride

1-(Aminomethyl)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol hydrochloride

CAS: 1427381-06-3

Versatile small molecule scaffold

Formula: C₁₂H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 243.73 g/mol

Ref: 3D-CHC38106