CAS 1427460-34-1

Imidazo[1,2-a]pyridine-2,7-dicarboxylic acid, 2-ethyl 7-methyl ester, hydrobromide (1:1)

Description:

Imidazo[1,2-a]pyridine-2,7-dicarboxylic acid, 2-ethyl 7-methyl ester, hydrobromide (1:1) is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, two carboxylic acid functional groups, and an ester moiety. The presence of the hydrobromide indicates that the compound is in a salt form, which can enhance its solubility in polar solvents. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential biological activity, making it of interest in pharmaceutical research. The ester groups suggest that it may participate in various chemical reactions, including hydrolysis and transesterification. Additionally, the presence of multiple functional groups can influence its reactivity and interaction with biological systems. As with many derivatives of heterocycles, it may exhibit a range of properties, including fluorescence or specific binding affinities, depending on its substituents and overall molecular conformation. Further studies would be necessary to elucidate its specific applications and biological activities.

Formula: C₁₂H₁₂N₂O₄·BrH

InChI: InChI=1S/C12H12N2O4.BrH/c1-3-18-12(16)9-7-14-5-4-8(11(15)17-2)6-10(14)13-9;/h4-7H,3H2,1-2H3;1H

InChI key: InChIKey=MKWWUGPBXBREEX-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C2N(C1)C=CC(C(OC)=O)=C2.Br

Synonyms:

• Imidazo[1,2-a]pyridine-2,7-dicarboxylic acid, 2-ethyl 7-methyl ester, hydrobromide (1:1)

2-Ethyl 7-methyl imidazo[1,2-a]pyridine-2,7-dicarboxylate hydrobromide

CAS: 1427460-34-1

2-Ethyl 7-methyl imidazo[1,2-a]pyridine-2,7-dicarboxylate hydrobromide

Purity: ≥95%

Molecular weight: 329.15g/mol

Ref: 54-OR110148