CAS 1427460-82-9

3-Bromoimidazo[1,2-a]pyridine-7-carboxylic acid hydrazide

Description:

3-Bromoimidazo[1,2-a]pyridine-7-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes an imidazole ring fused to a pyridine moiety, along with a carboxylic acid and hydrazide functional group. This compound typically exhibits properties associated with both heterocyclic compounds and hydrazides, such as potential biological activity and reactivity due to the presence of the bromine substituent and the hydrazide functional group. The imidazo and pyridine rings contribute to its aromatic character, which can influence its solubility and interaction with biological targets. The presence of the carboxylic acid group may enhance its ability to form hydrogen bonds, potentially affecting its pharmacological properties. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many heterocyclic compounds, the specific characteristics, including solubility, stability, and reactivity, can vary based on the surrounding environment and conditions.

Formula: C₈H₇BrN₄O

InChI: InChI=1S/C8H7BrN4O/c9-6-4-11-7-3-5(8(14)12-10)1-2-13(6)7/h1-4H,10H2,(H,12,14)

InChI key: InChIKey=RDDPPYAFZKDHNQ-UHFFFAOYSA-N

SMILES: BrC=1N2C(C=C(C(NN)=O)C=C2)=NC1

Synonyms:

• 3-Bromoimidazo[1,2-a]pyridine-7-carboxylic acid hydrazide
• Imidazo[1,2-a]pyridine-7-carboxylic acid, 3-bromo-, hydrazide

3-Bromoimidazo[1,2-a]pyridine-7-carbohydrazide

CAS: 1427460-82-9

3-Bromoimidazo[1,2-a]pyridine-7-carbohydrazide

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 255.07g/mol

Ref: 54-OR110147