
CAS 1427475-33-9: 1H-Imidazol-5-amine, 1,4-dimethyl-, hydrochloride (1:1)
Description:1H-Imidazol-5-amine, 1,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features two methyl groups at the 1 and 4 positions of the imidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and biochemistry. The presence of the amine functional group suggests potential basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is handled and stored. Overall, this compound represents a versatile building block in organic synthesis and drug development.
Formula:C5H9N3·ClH
InChI:InChI=1S/C5H9N3.ClH/c1-4-5(6)8(2)3-7-4;/h3H,6H2,1-2H3;1H
InChI key:InChIKey=IVIHPIMOKWJNPH-UHFFFAOYSA-N
SMILES:Cl.N1=CN(C(N)=C1C)C
- Synonyms:
- 1,4-Dimethyl-1H-imidazol-5-amine hydrochloride
- 1H-Imidazol-5-amine, 1,4-dimethyl-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Amino-1,4-dimethylimidazole Hydrochloride REF: IN-DA00346ICAS: 1427475-33-9 | 95% | 129.00 €~604.00 € | Tue 01 Apr 25 |
![]() | 5-Amino-1,4-dimethylimidazole hydrochloride REF: 3D-CHC47533CAS: 1427475-33-9 | Min. 95% | To inquire | Tue 13 May 25 |
![]() | 5-AMINO-1,4-DIMETHYLIMIDAZOLE HCL REF: 10-F387271CAS: 1427475-33-9 | 95.0% | - - - | Discontinued product |

5-Amino-1,4-dimethylimidazole Hydrochloride
Ref: IN-DA00346I
1g | 247.00 € | ||
5g | 604.00 € | ||
100mg | 129.00 € | ||
250mg | 152.00 € |

5-Amino-1,4-dimethylimidazole hydrochloride
Ref: 3D-CHC47533
5g | 1,012.00 € | ||
500mg | 425.00 € |

5-AMINO-1,4-DIMETHYLIMIDAZOLE HCL
Ref: 10-F387271
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |