
CAS 1427504-59-3
:7-Methyl-1H-pyrrolo[3,2-c]pyridine-2-carboxaldehyde
Description:
7-Methyl-1H-pyrrolo[3,2-c]pyridine-2-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a methyl group at the 7-position and an aldehyde functional group at the 2-position, which contributes to its reactivity and potential applications in organic synthesis. The presence of both nitrogen atoms in the ring system imparts unique electronic properties, making it of interest in medicinal chemistry and material science. Its molecular structure allows for various interactions, including hydrogen bonding and coordination with metal ions, which can be exploited in catalysis or as ligands in coordination chemistry. Additionally, the compound may exhibit biological activity, making it a candidate for further research in pharmacology. Its solubility and stability in different solvents can vary, influencing its practical applications. Overall, 7-Methyl-1H-pyrrolo[3,2-c]pyridine-2-carboxaldehyde is a versatile compound with potential implications in various fields of chemistry and biochemistry.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-6-3-10-4-7-2-8(5-12)11-9(6)7/h2-5,11H,1H3
InChI key:InChIKey=ZTYRPOCPXCOXKY-UHFFFAOYSA-N
SMILES:CC1=C2C(C=C(C=O)N2)=CN=C1
Synonyms:- 7-Methyl-1H-pyrrolo[3,2-c]pyridine-2-carboxaldehyde
- 1H-Pyrrolo[3,2-c]pyridine-2-carboxaldehyde, 7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.