CymitQuimica logo

CAS 1427588-39-3

:

8-Fluoro-3,4-dihydro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-quinolinone

Description:
8-Fluoro-3,4-dihydro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-quinolinone is a synthetic organic compound characterized by its complex structure, which includes a quinolinone core and a boron-containing moiety. The presence of the fluoro group enhances its potential for biological activity, possibly influencing its pharmacokinetic properties. The compound features a dioxaborolane ring, which is known for its ability to participate in various chemical reactions, including Suzuki coupling, making it valuable in medicinal chemistry and material science. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and its interactions with biological systems would require further investigation to elucidate its therapeutic potential. Overall, this compound exemplifies the intricate design often found in modern pharmaceuticals, combining elements that may enhance efficacy and specificity in biological applications.
Formula:C16H21BFNO3
InChI:InChI=1S/C16H21BFNO3/c1-15(2)16(3,4)22-17(21-15)11-8-10-6-7-13(20)19(5)14(10)12(18)9-11/h8-9H,6-7H2,1-5H3
InChI key:InChIKey=OBDDZPKMIQMIHQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C3C(=C(F)C2)N(C)C(=O)CC3
Synonyms:
  • 8-Fluoro-3,4-dihydro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-quinolinone
  • 2(1H)-Quinolinone, 8-fluoro-3,4-dihydro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.