
CAS 1427588-52-0
:6-Bromo-5-fluoro-3,4-dihydro-1-methyl-2(1H)-quinolinone
Description:
6-Bromo-5-fluoro-3,4-dihydro-1-methyl-2(1H)-quinolinone is a heterocyclic organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing both a benzene and a pyridine ring. The presence of bromine and fluorine substituents introduces unique electronic and steric properties, influencing its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate to high lipophilicity due to its aromatic nature, which may enhance its bioavailability in biological systems. The dihydro form indicates the presence of saturated carbon atoms, contributing to its stability and potentially affecting its interaction with biological targets. Additionally, the methyl group at the nitrogen position can influence the compound's basicity and solubility. Overall, 6-Bromo-5-fluoro-3,4-dihydro-1-methyl-2(1H)-quinolinone is of interest in pharmaceutical research, particularly for its potential as a lead compound in drug development, owing to its structural features that may interact with various biological pathways.
Formula:C10H9BrFNO
InChI:InChI=1S/C10H9BrFNO/c1-13-8-4-3-7(11)10(12)6(8)2-5-9(13)14/h3-4H,2,5H2,1H3
InChI key:InChIKey=HMZZDESEQNGQMH-UHFFFAOYSA-N
SMILES:FC1=C2C(N(C)C(=O)CC2)=CC=C1Br
Synonyms:- 2(1H)-Quinolinone, 6-bromo-5-fluoro-3,4-dihydro-1-methyl-
- 6-Bromo-5-fluoro-3,4-dihydro-1-methyl-2(1H)-quinolinone
- 6-Bromo-5-fluoro-1-methyl-3,4-dihydroquinolin-2-one
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery