CAS 142761-11-3
:R-(-)-O-DESMETHYLVENLAFAXINE
Description:
R-(-)-O-Desmethylvenlafaxine, with the CAS number 142761-11-3, is a chemical compound that serves as a metabolite of venlafaxine, an antidepressant medication. This substance is characterized by its chiral nature, possessing a specific stereochemistry that contributes to its pharmacological activity. It is primarily recognized for its role as a serotonin-norepinephrine reuptake inhibitor (SNRI), which means it influences the reuptake of neurotransmitters serotonin and norepinephrine in the brain, potentially enhancing mood and alleviating symptoms of depression. The compound is typically found in a crystalline form and is soluble in organic solvents, reflecting its chemical structure. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are essential for understanding its therapeutic effects and potential side effects. As a research chemical, R-(-)-O-Desmethylvenlafaxine is of interest in studies related to mental health and pharmacology, particularly in the context of developing more effective antidepressant therapies.
Formula:C16H25NO2
InChI:InChI=1/C16H25NO2/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16/h6-9,15,18-19H,3-5,10-12H2,1-2H3/t15-/m0/s1
SMILES:CN(C)C[C@@H](c1ccc(cc1)O)C1(CCCCC1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-O-Desmethyl-Venlafaxine
CAS:Formula:C16H25NO2Color and Shape:White To Off-White SolidMolecular weight:263.38R-(-)-O-Desmethyl Venlafaxine
CAS:Controlled Product<p>Applications A metabolite of Venlafaxine, a selective serotonin noradrenaline reuptake inhibitor. Used as an antidepressant.<br></p>Formula:C16H25NO2Color and Shape:NeatMolecular weight:263.384-(2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl)phenol
CAS:Controlled ProductVenlafaxine is a selective serotonin and norepinephrine reuptake inhibitor (SNRI) that is used to treat depression. Venlafaxine inhibits the reuptake of serotonin and norepinephrine into the presynaptic neuron, increasing their availability in the synaptic cleft. Venlafaxine has been shown to be effective in treating major depressive disorder and other depressive disorders, such as dysthymia and post-partum depression. The antidepressant effects of venlafaxine are believed to be due to its ability to block the uptake of serotonin and norepinephrine in the brain, resulting in an increased concentration of these neurotransmitters. Venlafaxine is metabolized by CYP2D6, CYP3A4, CYP1A2 and CYP2C19 enzymes, which may result in drug interactions with other drugs metabolized by these enzymes. To control for this effect, venlafaxine bloodFormula:C16H25NO2Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:263.38 g/mol



