CAS 142770-42-1
:1-chloro-4-propoxy-9H-thioxanthen-9-one
Description:
1-Chloro-4-propoxy-9H-thioxanthen-9-one is an organic compound characterized by its thioxanthene core, which features a sulfur atom in place of one of the carbon atoms typically found in the anthracene structure. This compound contains a chloro substituent at the 1-position and a propoxy group at the 4-position, contributing to its unique chemical properties. The presence of the chlorine atom can influence the compound's reactivity and polarity, while the propoxy group enhances its solubility in organic solvents. Thioxanthenes are known for their applications in various fields, including pharmaceuticals and materials science, due to their photochemical properties. The compound may exhibit fluorescence and has potential uses in dye applications or as a photoinitiator in polymerization processes. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile compound in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of chlorine and the potential for reactivity.
Formula:C16H13ClO2S
InChI:InChI=1/C16H13ClO2S/c1-2-9-19-12-8-7-11(17)14-15(18)10-5-3-4-6-13(10)20-16(12)14/h3-8H,2,9H2,1H3
InChI key:InChIKey=VKQJCUYEEABXNK-UHFFFAOYSA-N
SMILES:O(CCC)C1=C2C(C(=O)C=3C(S2)=CC=CC3)=C(Cl)C=C1
Synonyms:- 1-Chloro-4-propoxy-9H-thioxanthone
- 1-Chloro-4-propoxythioxanthone
- 9H-Thioxanthen-9-one, 1-chloro-4-propoxy-
- Irgacure CPTX
- Kayacure CPTX
- Photoinitiator-CPTX
- Quantacure CPTX
- Runtecure 1108
- Speedcure CPTX
- 1-Chloro-4-propoxy-9H-thioxanthen-9-one
- 1-Chloro-4-propoxy-10H-dibenzo[b,e]thiopyran-10-one
- 1-Chloro-4-propoxythioxanthone, CPTX
- 1-Chloro-4-propoxy-9H-thioxanthen-9-one 97%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
9H-Thioxanthen-9-one,1-chloro-4-propoxy-
CAS:Formula:C16H13ClO2SPurity:97%Color and Shape:SolidMolecular weight:304.79121-Chloro-4-Propoxy-9H-Thioxanthen-9-One
CAS:1-Chloro-4-Propoxy-9H-Thioxanthen-9-OnePurity:99%Molecular weight:304.79g/mol1-Chloro-4-propoxy-9H-thioxanthen-9-one
CAS:Applications 1-Chloro-4-propoxy-9H-thioxanthen-9-one (cas# 142770-42-1) is a useful research chemical.
Formula:C16H13ClO2SColor and Shape:NeatMolecular weight:304.791-CHLORO-4-PROPOXYTHIOXANTHONE
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:304.79000854492191-Chloro-4-propoxy-9H-thioxanthen-9-one
CAS:1-Chloro-4-propoxy-9H-thioxanthen-9-one is a photoinitiator that is used in the polymerization of cationic monomers. Propylene glycol (PG) and acetonitrile are solvents for this compound, which can be synthesized from propylene oxide and thioxanthone. This initiator is also used in the synthesis of steroid hormones. Irradiation with UV light causes the production of reactive oxygen species that can crosslink the polymer chains. The matrix effect occurs when the initiator concentration is high, leading to increased polymerization rates. The gel permeation chromatography technique can be used to measure the molecular weight of polymers produced by this initiator.Formula:C16H13ClO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:304.79 g/mol1-Chloro-4-propoxy-9H-thioxanthen-9-one
CAS:Formula:C16H13ClO2SPurity:>98.0%(GC)Color and Shape:Light yellow to Yellow powder to crystalMolecular weight:304.79






