CAS 142773-73-7
:(2'S,3S)-1-(2-Methylamino-2-Phenyl-Ethyl)-Pyrrolidin-3-ol
Description:
The chemical substance known as (2'S,3S)-1-(2-Methylamino-2-Phenyl-Ethyl)-Pyrrolidin-3-ol, with the CAS number 142773-73-7, is a chiral compound characterized by its pyrrolidine ring structure, which contributes to its stereochemistry. This compound features a hydroxyl group (-OH) at the 3-position of the pyrrolidine, indicating it is an alcohol, and a 2-methylamino-2-phenyl-ethyl side chain, which suggests potential biological activity. The presence of the methylamino group may enhance its interaction with biological targets, possibly influencing its pharmacological properties. The stereochemistry, denoted by the (2'S,3S) configuration, implies that the compound can exhibit specific interactions in biological systems, which is crucial for its potential therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and stereochemistry, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H20N2O
InChI:InChI=1/C13H20N2O/c1-14-13(11-5-3-2-4-6-11)10-15-8-7-12(16)9-15/h2-6,12-14,16H,7-10H2,1H3/t12-,13+/m0/s1
Synonyms:- (3S)-1-[(2S)-2-(Methylamino)-2-phenylethyl]pyrrolidin-3-ol
- 3-Pyrrolidinol, 1-[(2S)-2-(methylamino)-2-phenylethyl]-, (3S)-
- (2'S,3S)-1-(2-Methylamino-2-phenylethyl)-pyrrolidin-3-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2'S,3S)-1-(2-METHYLAMINO-2-PHENYL-ETHYL)-PYRROLIDIN-3-OL
CAS:Formula:C13H20N2OMolecular weight:220.3107(2’S,3S)-1-(2-Methylamino-2-phenyl-ethyl)-pyrrolidin-3-ol
CAS:Formula:C13H20N2OPurity:97.0%Molecular weight:220.316(3S)-1-(2-Methylamino-(2S)-2-phenylethyl)pyrrolidin-3-ol-d5
CAS:Controlled ProductApplications (3S)-1-(2-Methylamino-(2S)-2-phenylethyl)pyrrolidin-3-ol-d5 is an intermediate in the synthesis of Asimadoline-d5 Hydrochloride (Asimadoline-d5 Hydrochloride). Isotope labelled Asimadoline Hydrochlorine is used in the treatment of IBS, a disorder associated with pain and altered bowel function.
References Mangel, A. et al.: Clin. Exp. Gastroenterol., 5, 1 (2012)Formula:C13D5H15N2OColor and Shape:NeatMolecular weight:225.341(2'S,3S)-1-(2-Methylamino-2-phenyl-ethyl)-pyrrolidin-3-ol
CAS:Controlled ProductFormula:C13H20N2OColor and Shape:NeatMolecular weight:220.311


