CAS 142784-25-6
:N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine
Description:
N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine is a chemical compound that belongs to the class of heterocyclic aromatic amines. This substance is notable for its structural features, which include a deoxyguanosine moiety linked to an imidazo(4,5-b)pyridine framework. The presence of the amino and methyl groups contributes to its reactivity and potential biological activity. This compound is of interest in the field of medicinal chemistry and toxicology, particularly due to its potential role as a DNA adduct, which may influence mutagenesis and carcinogenesis. Its molecular structure suggests that it may interact with nucleic acids, potentially leading to alterations in genetic material. The compound's properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Research into this compound may provide insights into its mechanisms of action and implications for health and disease.
Formula:C23H23N9O4
InChI:InChI=1/C23H23N9O4/c1-31-13-7-12(11-5-3-2-4-6-11)9-25-18(13)27-22(31)30-23-26-17-19(28-21(24)29-20(17)35)32(23)16-8-14(34)15(10-33)36-16/h2-7,9,14-16,33-34H,8,10H2,1H3,(H3,24,28,29,35)(H,25,26,27,30)/t14-,15+,16+/m0/s1
Synonyms:- 2'-Deoxy-8-[(1-methyl-6-phenyl-1H-imidazo[4,5-b]pyridin-2-yl)amino]guanosine
- N-(Deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo[4,5-]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-(Deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo[4,5-β]pyridine
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications The DNA adduct formed from N-Hydroxy-PHIP. Mutagenic nucleotide incorporation and hindered translocation by a food carcinogen C8-dG adduct in Sulfolobus solfataricus P2 DNA polymerase IV (Dpo4).<br>References Frandsen, H., et al.: Carcinogenesis, 13, 4, 629 (1992), Lin, D., et al.: Chem. Res. Toxicol., 5, 691 (1993), Mizukami, S., et al.: Biochemistry, 45, 2772 (2006),<br></p>Formula:C23H23N9O4Color and Shape:NeatMolecular weight:489.498-(2-Amino-1-methyl-6-phenylimidazo[4,5-b]pyridyl)-2'-deoxyguanosine
CAS:8-(2-Amino-1-methyl-6-phenylimidazo[4,5-b]pyridyl)-2'-deoxyguanosine (8-APdG) is a mutagen that induces genotoxic effects and mutations in mammalian cells. It has been shown to react with DNA to form covalent complexes and induce point mutations or transversions. 8-APdG has been found in the environment as a result of environmental pollution by polycyclic aromatic hydrocarbons and tobacco smoke. 8-APdG also induces genetic damage in human lymphoblastoid cells in vitro, including mutations at the HPRT locus.Formula:C23H23N9O4Purity:Min. 95%Molecular weight:489.49 g/mol


