CAS 14279-91-5
:4-CHLOROPHENYLGUANIDINE HYDROCHLORIDE
Description:
4-Chlorophenylguanidine hydrochloride is a chemical compound characterized by its guanidine structure, which features a phenyl group substituted with a chlorine atom at the para position. This compound is typically encountered as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various applications. It is primarily utilized in biochemical research and pharmacological studies, particularly in the investigation of its effects on ion channels and receptors. The presence of the chlorine atom enhances its biological activity and modulates its interaction with cellular targets. As with many guanidine derivatives, it may exhibit properties such as being a potential analgesic or having effects on the central nervous system. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Proper storage conditions are also essential to maintain its stability and efficacy in research applications.
Formula:C7H9ClN3
InChI:InChI=1/C7H8ClN3/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4H,(H4,9,10,11)/p+1
Synonyms:- 4-ChlorophenylguanidineHCl
- 4-chloro-N-(diaminomethylidene)anilinium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Chlorophenylguanidine hydrochloride
CAS:Formula:C7H9Cl2N3Purity:95%Color and Shape:SolidMolecular weight:206.07254-Chlorophenylguanidine hydrochloride
CAS:4-Chlorophenylguanidine hydrochloridePurity:≥95%Molecular weight:206.07g/mol4-Chlorophenylguanidine hydrochloride
CAS:<p>4-Chlorophenylguanidine hydrochloride is a potent inhibitor of urokinase selectivity. </p>Formula:C7H9Cl2N3Purity:99.75%Color and Shape:SolidMolecular weight:206.07p-Chlorophenylguanidine Hydrochloride
CAS:Controlled Product<p>Applications p-Chlorophenylguanidine Hydrochloride is an reagent used in the synthesis of pyrimidine derivatives as hSMG-1 inhibitors, potential targets for cancer treatment.<br>References Gopalsamy, A., et al.: Bioorg. Med. Chem. Lett., 22, 6636 (2012);<br></p>Formula:C7H8ClN3·ClHColor and Shape:NeatMolecular weight:206.074-Chlorophenylguanidine hydrochloride
CAS:<p>Versatile small molecule scaffold</p>Formula:C7H8ClN3·HClPurity:Min. 95%Molecular weight:206.07 g/mol






