CAS 142796-22-3
:Isosilybin B
Description:
Isosilybin B is a flavonoid compound derived from the milk thistle plant, specifically from its active component silymarin. It is known for its potential hepatoprotective properties, which may help in protecting liver cells from damage caused by toxins and oxidative stress. Isosilybin B exhibits antioxidant activity, which contributes to its protective effects on the liver. The compound has been studied for its potential therapeutic applications in various liver diseases, including hepatitis and cirrhosis. Additionally, Isosilybin B may possess anti-inflammatory and anticancer properties, making it a subject of interest in pharmacological research. Its chemical structure includes multiple hydroxyl groups, which are responsible for its biological activity. The compound is typically found in a natural form and can be extracted from the seeds of the milk thistle plant. As with many natural products, further research is necessary to fully understand its mechanisms of action and potential clinical applications.
Formula:C25H22O10
InChI:InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-18-7-12(3-5-16(18)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20-,23-,24-,25+/m0/s1
InChI key:InChIKey=FDQAOULAVFHKBX-WAABAYLZSA-N
SMILES:C(O)[C@H]1[C@@H](OC=2C(O1)=CC(=CC2)[C@H]3OC=4C(C(=O)[C@@H]3O)=C(O)C=C(O)C4)C5=CC(OC)=C(O)C=C5
Synonyms:- Silybin a2
- Isosilybin B
- 4H-1-Benzopyran-4-one, 2-[(2S,3S)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-
- (2R,3R)-2-[(2S,3S)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
- 1,4-Benzodioxin, 4H-1-benzopyran-4-one deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Isosilybin B
CAS:Isosilybin B, from silymarin, hinders PCA, stops cell growth, causes G1 arrest and apoptosis, and breaks down androgen receptors.Formula:C25H22O10Purity:99.96%Color and Shape:SolidMolecular weight:482.44Isosilybin b
CAS:Oxygen-heterocyclic compoundFormula:C25H22O10Purity:≥ 80.0 % (HPLC)Color and Shape:PowderMolecular weight:482.44Isosilybin B
CAS:Isosilybin B is an active component of silymarin, which is a complex of flavonolignans derived from the seeds of the milk thistle plant, *Silybum marianum*. This compound is characterized as a powerful antioxidant, functioning through scavenging free radicals and modulating enzymatic activities involved in oxidative stress pathways. Isosilybin B distinguishes itself by influencing cell signaling pathways and gene expression, thereby exerting cellular protective effects, which make it particularly interesting for research in hepatoprotection and chemoprevention.Formula:C25H22O10Purity:Min. 95%Molecular weight:482.44 g/mol







