CAS 142796-22-3: Isosilybin B
Description:Isosilybin B is a flavonoid compound derived from the milk thistle plant, specifically from its active component silymarin. It is known for its potential hepatoprotective properties, which may help in protecting liver cells from damage caused by toxins and oxidative stress. Isosilybin B exhibits antioxidant activity, which contributes to its protective effects on the liver. The compound has been studied for its potential therapeutic applications in various liver diseases, including hepatitis and cirrhosis. Additionally, Isosilybin B may possess anti-inflammatory and anticancer properties, making it a subject of interest in pharmacological research. Its chemical structure includes multiple hydroxyl groups, which are responsible for its biological activity. The compound is typically found in a natural form and can be extracted from the seeds of the milk thistle plant. As with many natural products, further research is necessary to fully understand its mechanisms of action and potential clinical applications.
Formula:C25H22O10
InChI:InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-18-7-12(3-5-16(18)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20-,23-,24-,25+/m0/s1
InChI key:InChIKey=FDQAOULAVFHKBX-WAABAYLZSA-N
SMILES:O=C1C=2C(O)=CC(O)=CC2OC(C3=CC=C4OC(C5=CC=C(O)C(OC)=C5)C(OC4=C3)CO)C1O
- Synonyms:
- Silybin a2
- Isosilybin B
- 4H-1-Benzopyran-4-one, 2-[(2S,3S)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-
- (2R,3R)-2-[(2S,3S)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
- 1,4-Benzodioxin, 4H-1-benzopyran-4-one deriv.