CAS 142796-24-5

2-[(2S,3S)-2,3-Dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-3,5,7-trihydroxy-4H-1-benzopyran-4-one

Description:

The chemical substance known as "2-[(2S,3S)-2,3-Dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-3,5,7-trihydroxy-4H-1-benzopyran-4-one," with the CAS number 142796-24-5, is a complex organic compound characterized by its polyphenolic structure. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of a benzopyran moiety indicates that it may exhibit biological activity, possibly including anti-inflammatory or anticancer effects. The compound's stereochemistry, particularly the (2S,3S) configuration, suggests specific spatial arrangements that could influence its interaction with biological targets. Additionally, the methoxy and hydroxy substituents on the aromatic rings enhance its solubility and reactivity. This compound is of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic applications. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities are necessary to fully understand its utility in clinical settings.

Formula: C₂₅H₂₀O₁₀

InChI: InChI=1S/C25H20O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-16-5-3-12(7-18(16)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,24,26-29,31H,10H2,1H3/t20-,24-/m0/s1

InChI key: InChIKey=BVKQRAYKLBRNIK-RDPSFJRHSA-N

SMILES: C(O)[C@H]1[C@@H](OC=2C(O1)=CC=C(C2)C=3OC=4C(C(=O)C3O)=C(O)C=C(O)C4)C5=CC(OC)=C(O)C=C5

Synonyms:

• 2-[(2S,3S)-2,3-Dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-3,5,7-trihydroxy-4H-1-benzopyran-4-one
• Dehydrosilybin B
• 1,4-Benzodioxin, 4H-1-benzopyran-4-one deriv.
• 2,3-Dehydrosilybin B
• 4H-1-Benzopyran-4-one, 2-[(2S,3S)-2,3-dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-3,5,7-trihydroxy-

2,3-Dehydrosilybin B

CAS: 142796-24-5

2,3-Dehydrosilybin B is a useful organic compound for research related to life sciences and the catalog number is T125883.

Formula: C₂₅H₂₀O₁₀

Color and Shape: Solid

Molecular weight: 480.42

Ref: TM-T125883

2,3-Dehydrosilybin B

CAS: 142796-24-5

Formula: C₂₅H₂₀O₁₀

Molecular weight: 480.43

Ref: 4Z-S-3914

2,3-dehydrosilybin b

CAS: 142796-24-5

Oxygen-heterocyclic compound

Formula: C₂₅H₂₀O₁₀

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 480.43

Ref: 5G-82878

2,3-Dehydrosilybin B

CAS: 142796-24-5

2,3-Dehydrosilybin B is a flavonoid derivative, which is a chemically modified form of silybin. It is derived from the milk thistle plant (Silybum marianum) and is primarily recognized for its potential health benefits. This compound is known to exert its effects through antioxidant mechanisms, providing protection against oxidative stress by scavenging free radicals and modulating enzymatic activity associated with cellular oxidative processes.

Formula: C₂₅H₂₀O₁₀

Purity: Min. 95%

Molecular weight: 480.42 g/mol

Ref: 3D-SFA79624

2,3-Dehydrosilybin B

CAS: 142796-24-5

Formula: C₂₅H₂₀O₁₀

Molecular weight: 480.4

Ref: ST-EA-CP-S87008