CAS 142809-89-0
:Clinopodiside A
Description:
Clinopodiside A, with the CAS number 142809-89-0, is a natural compound classified as a triterpenoid saponin. It is primarily derived from the plant species Clinopodium, which is known for its diverse phytochemical profile. This compound exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer properties, making it of interest in pharmacological research. Clinopodiside A is characterized by its complex glycosidic structure, which contributes to its solubility and interaction with biological membranes. The presence of sugar moieties in its structure enhances its bioactivity and may influence its pharmacokinetics. Additionally, studies have indicated that saponins like Clinopodiside A can modulate immune responses, suggesting potential applications in immunotherapy. However, further research is necessary to fully elucidate its mechanisms of action and therapeutic potential. As with many natural products, the extraction and purification processes are crucial for obtaining Clinopodiside A in sufficient quantities for study and application.
Formula:C48H78O19
InChI:InChI=1/C48H78O19/c1-43(2)13-14-48(21-52)23(15-43)22-7-8-28-44(3)11-10-30(45(4,20-51)27(44)9-12-46(28,5)47(22,6)16-29(48)53)66-41-38(61)35(58)39(67-42-37(60)34(57)32(55)25(18-50)64-42)26(65-41)19-62-40-36(59)33(56)31(54)24(17-49)63-40/h7-8,24-42,49-61H,9-21H2,1-6H3
SMILES:CC1(C)CCC2(CO)C(=C3C=CC4C5(C)CCC(C(C)(CO)C5CCC4(C)C3(C)CC2O)OC2C(C(C(C(COC3C(C(C(C(CO)O3)O)O)O)O2)OC2C(C(C(C(CO)O2)O)O)O)O)O)C1
Synonyms:- 16,23,28-Trihydroxyoleana-11,13(18)-Dien-3-Yl Hexopyranosyl-(1->4)-[Hexopyranosyl-(1->6)]Hexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Clinopodiside A
CAS:Clinopodiside A is a natural product from Clinopodium chinense.Formula:C66H114O19Purity:97.044%Color and Shape:SolidMolecular weight:1211.62Clinopodiside A
CAS:Clinopodiside A is a bioactive compound, which is a natural triterpenoid saponin isolated from plants belonging to the genus Clinopodium. This compound is sourced specifically from Clinopodium chinense, a species traditionally utilized in herbal medicine. The mode of action of Clinopodiside A primarily involves modulation of cellular processes through its interaction with cell membranes and signaling pathways, leading to various biological effects.Formula:C48H78O19Purity:Min. 95%Molecular weight:959.12 g/mol


