CAS 142810-19-3

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valylglycine

Description:

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valylglycine, commonly referred to as Fmoc-Val-Gly, is a chemical compound widely used in peptide synthesis as a protecting group for amino acids. The Fmoc (fluorenylmethyloxycarbonyl) group is particularly favored due to its stability under basic conditions and ease of removal under mild acidic conditions. This compound features a valine and glycine moiety, contributing to its role in forming peptide bonds. It is typically a white to off-white solid, soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. The presence of the fluorenyl group enhances its photophysical properties, making it useful in various applications, including drug development and bioconjugation. Additionally, the compound's structure allows for specific interactions in biological systems, making it valuable in research involving peptide-based therapeutics. Proper handling and storage are essential due to its reactivity and potential sensitivity to moisture and light.

Formula: C₂₂H₂₄N₂O₅

InChI: InChI=1S/C22H24N2O5/c1-13(2)20(21(27)23-11-19(25)26)24-22(28)29-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18,20H,11-12H2,1-2H3,(H,23,27)(H,24,28)(H,25,26)/t20-/m0/s1

InChI key: InChIKey=RWMPPRIMKZLKTB-FQEVSTJZSA-N

SMILES: C(OC(N[C@H](C(NCC(O)=O)=O)C(C)C)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2

Synonyms:

• Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl-
• N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valylglycine
• (S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanamido)acetic acid
• Glycine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl]-
• 2-[(2S)-2-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)-3-methylbutanamido]acetic acid

Fmoc-Val-Gly-OH

CAS: 142810-19-3

Bachem ID: 4027398.

Formula: C₂₂H₂₄N₂O₅

Purity: 99.7%

Color and Shape: White Powder

Molecular weight: 396.44

Ref: 01-4027398

Fmoc-Val-Gly-OH

CAS: 142810-19-3

Fmoc-Val-Gly-OH

Purity: 98%

Molecular weight: 396.44g/mol

Ref: 54-OR36447

Fmoc-Val-Gly-OH

CAS: 142810-19-3

Fmoc-Val-Gly-OH is a Research Chemical that is commonly used in the field of efficient synthesis. It is an amino acyl compound that can be utilized for the synthesis of various molecules. Fmoc-Val-Gly-OH is known for its high efficiency and reliability in producing desired results. It can be easily analyzed using spectrometry techniques, allowing researchers to accurately determine its composition and purity. This versatile compound can react with azides, alcohols, and other compounds to create new chemical entities. With its efficient properties, Fmoc-Val-Gly-OH is an essential tool for scientists and researchers in their quest for innovative discoveries.

Formula: C₂₂H₂₄N₂O₅

Purity: Min. 95%

Molecular weight: 396.44 g/mol

Ref: 3D-FF111329

Glycine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl]-

CAS: 142810-19-3

Purity: 98%

Color and Shape: Solid

Molecular weight: 396.4429932

Ref: 10-F863140