CAS 142810-19-3
:N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valylglycine
Description:
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valylglycine, commonly referred to as Fmoc-Val-Gly, is a chemical compound widely used in peptide synthesis as a protecting group for amino acids. The Fmoc (fluorenylmethyloxycarbonyl) group is particularly favored due to its stability under basic conditions and ease of removal under mild acidic conditions. This compound features a valine and glycine moiety, contributing to its role in forming peptide bonds. It is typically a white to off-white solid, soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. The presence of the fluorenyl group enhances its photophysical properties, making it useful in various applications, including drug development and bioconjugation. Additionally, the compound's structure allows for specific interactions in biological systems, making it valuable in research involving peptide-based therapeutics. Proper handling and storage are essential due to its reactivity and potential sensitivity to moisture and light.
Formula:C22H24N2O5
InChI:InChI=1S/C22H24N2O5/c1-13(2)20(21(27)23-11-19(25)26)24-22(28)29-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18,20H,11-12H2,1-2H3,(H,23,27)(H,24,28)(H,25,26)/t20-/m0/s1
InChI key:InChIKey=RWMPPRIMKZLKTB-FQEVSTJZSA-N
SMILES:C(OC(N[C@H](C(NCC(O)=O)=O)C(C)C)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl-
- N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valylglycine
- (S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanamido)acetic acid
- Glycine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl]-
- 2-[(2S)-2-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)-3-methylbutanamido]acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Fmoc-Val-Gly-OH
CAS:<p>Bachem ID: 4027398.</p>Formula:C22H24N2O5Purity:99.7%Color and Shape:White PowderMolecular weight:396.44Fmoc-Val-Gly-OH
CAS:<p>Fmoc-Val-Gly-OH is a Research Chemical that is commonly used in the field of efficient synthesis. It is an amino acyl compound that can be utilized for the synthesis of various molecules. Fmoc-Val-Gly-OH is known for its high efficiency and reliability in producing desired results. It can be easily analyzed using spectrometry techniques, allowing researchers to accurately determine its composition and purity. This versatile compound can react with azides, alcohols, and other compounds to create new chemical entities. With its efficient properties, Fmoc-Val-Gly-OH is an essential tool for scientists and researchers in their quest for innovative discoveries.</p>Formula:C22H24N2O5Purity:Min. 95%Molecular weight:396.44 g/molGlycine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl]-
CAS:Purity:98%Color and Shape:SolidMolecular weight:396.4429932



