CAS 142810-49-9

Cyclohexanecarboxamide,N-(4-chlorophenyl)-

Description:

Cyclohexanecarboxamide, N-(4-chlorophenyl)-, is an organic compound characterized by its amide functional group attached to a cyclohexane ring and a para-chlorophenyl substituent. This compound typically exhibits a solid state at room temperature and is likely to be white to off-white in color. Its molecular structure suggests moderate polarity due to the presence of the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The para-chlorophenyl group may impart additional properties such as increased lipophilicity and potential biological activity, making it of interest in pharmaceutical and agrochemical research. The presence of the chlorine atom can also affect the compound's reactivity and stability. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, Cyclohexanecarboxamide, N-(4-chlorophenyl)-, represents a class of compounds that may have applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₃H₁₆ClNO

InChI: InChI=1/C13H16ClNO/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,15,16)

SMILES: C1CCC(CC1)C(=O)Nc1ccc(cc1)Cl

Synonyms:

• N-(4-chlorophenyl)cyclohexanecarboxamide

N-(4-Chlorophenyl)Cyclohexanecarboxamide

CAS: 142810-49-9

N-(4-Chlorophenyl)Cyclohexanecarboxamide

Purity: 97%

Molecular weight: 237.73g/mol

Ref: 54-OR1028531

N-(4-Chlorophenyl)cyclohexanecarboxamide

CAS: 142810-49-9

Formula: C₁₃H₁₆ClNO

Purity: 95.0%

Molecular weight: 237.73

Ref: 10-F216707