CymitQuimica logo

CAS 1428139-16-5

:

2-Ethoxy-4-(5-methyl-2-thienyl)-6-oxo-1-cyclohexene-1-carbonitrile

Description:
2-Ethoxy-4-(5-methyl-2-thienyl)-6-oxo-1-cyclohexene-1-carbonitrile is a synthetic organic compound characterized by its complex structure, which includes a cyclohexene ring, a carbonitrile functional group, and an ethoxy substituent. The presence of the thienyl group introduces heteroatoms into the molecule, contributing to its unique chemical properties and potential reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical research. Its oxo group suggests potential for reactivity in nucleophilic addition reactions, while the carbonitrile group can participate in various chemical transformations. The ethoxy group may influence the solubility and polarity of the compound, affecting its interactions in biological systems. Overall, the characteristics of this compound, including its molecular weight, solubility, and stability, would be essential for understanding its applications in medicinal chemistry and material science. Further studies would be necessary to explore its specific properties and potential uses.
Formula:C14H15NO2S
InChI:InChI=1S/C14H15NO2S/c1-3-17-13-7-10(6-12(16)11(13)8-15)14-5-4-9(2)18-14/h4-5,10H,3,6-7H2,1-2H3
InChI key:InChIKey=CPBJUCIKSKDZAC-UHFFFAOYSA-N
SMILES:O(CC)C=1CC(CC(=O)C1C#N)C2=CC=C(C)S2
Synonyms:
  • 2-Ethoxy-4-(5-methyl-2-thienyl)-6-oxo-1-cyclohexene-1-carbonitrile
  • 1-Cyclohexene-1-carbonitrile, 2-ethoxy-4-(5-methyl-2-thienyl)-6-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.