CymitQuimica logo

CAS 1428139-43-8

:

4,4a-Dihydro-4-(5-methyl-2-thienyl)-1H-pyrimido[4,5-b]indol-2-amine

Description:
4,4a-Dihydro-4-(5-methyl-2-thienyl)-1H-pyrimido[4,5-b]indol-2-amine is a chemical compound characterized by its complex structure, which includes a pyrimidoindole framework. This compound features a dihydro form, indicating the presence of a saturated ring system, and a thienyl group, which contributes to its aromatic properties and potential reactivity. The presence of the methyl group on the thienyl ring can influence the compound's electronic properties and steric hindrance. As an amine, it possesses basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The compound's unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. Its CAS number, 1428139-43-8, allows for precise identification in chemical databases. Overall, this compound exemplifies the intricate interplay of heterocyclic chemistry and potential pharmacological applications.
Formula:C15H14N4S
InChI:InChI=1S/C15H14N4S/c1-8-6-7-11(20-8)13-12-9-4-2-3-5-10(9)17-14(12)19-15(16)18-13/h2-7,12-13H,1H3,(H3,16,17,18,19)
InChI key:InChIKey=URSVULOYNKDGKH-UHFFFAOYSA-N
SMILES:NC1=NC(C2C=3C(NC2=N1)=CC=CC3)C=4SC(C)=CC4
Synonyms:
  • 4,4a-Dihydro-4-(5-methyl-2-thienyl)-1H-pyrimido[4,5-b]indol-2-amine
  • 1H-Pyrimido[4,5-b]indol-2-amine, 4,4a-dihydro-4-(5-methyl-2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.