CAS 1428139-55-2

2,4-Dichloro-5-(2-thienyl)thieno[2,3-d]pyrimidine

Description:

2,4-Dichloro-5-(2-thienyl)thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrimidine ring fused with a thieno ring system. This compound features two chlorine atoms at the 2 and 4 positions of the pyrimidine ring, contributing to its reactivity and potential biological activity. The presence of a thienyl group at the 5 position enhances its electronic properties and may influence its interactions with biological targets. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting properties such as antimicrobial or antifungal activity, although specific biological data would be necessary to confirm such effects. Additionally, the presence of chlorine atoms often affects solubility and stability, making it a subject of interest in material science and medicinal chemistry. Overall, 2,4-Dichloro-5-(2-thienyl)thieno[2,3-d]pyrimidine represents a class of compounds with diverse potential applications in various fields of research.

Formula: C₁₀H₄Cl₂N₂S₂

InChI: InChI=1S/C10H4Cl2N2S2/c11-8-7-5(6-2-1-3-15-6)4-16-9(7)14-10(12)13-8/h1-4H

InChI key: InChIKey=CULKNUZFOKJBKR-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CSC2=NC(Cl)=N1)C3=CC=CS3

Synonyms:

• Thieno[2,3-d]pyrimidine, 2,4-dichloro-5-(2-thienyl)-
• 2,4-Dichloro-5-(2-thienyl)thieno[2,3-d]pyrimidine