CAS 142826-45-7
:(2,7-OCTADIEN-1-YL)SUCCINIC ANHYDRIDE
Description:
(2,7-Octadien-1-yl)succinic anhydride is a chemical compound characterized by its unique structure, which includes a succinic anhydride moiety and a long-chain diene. This compound features a conjugated diene system, which imparts reactivity and potential for polymerization, making it useful in various chemical applications. The presence of the anhydride functional group suggests that it can undergo reactions typical of anhydrides, such as nucleophilic attack by alcohols or amines, leading to the formation of esters or amides. Its structure allows for potential applications in the synthesis of polymers, coatings, and as a reactive intermediate in organic synthesis. Additionally, the compound may exhibit properties such as low volatility and moderate solubility in organic solvents, which are common for similar anhydride compounds. Safety considerations should be taken into account, as anhydrides can be irritants and may pose health risks upon exposure. Overall, (2,7-octadien-1-yl)succinic anhydride is a versatile compound with significant potential in chemical synthesis and materials science.
Formula:C12H16O3
InChI:InChI=1/C12H16O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14/h2,6-7,10H,1,3-5,8-9H2/b7-6+
Synonyms:- 4,9-Decadiene-1,2-Dicarboxylic Anhydride
- 3-[(2E)-octa-2,7-dien-1-yl]dihydrofuran-2,5-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2,7-Octadien-1-yl)succinic Anhydride
CAS:Formula:C12H16O3Purity:97%Color and Shape:LiquidMolecular weight:208.25363-(Octa-2,7-dien-1-yl)dihydrofuran-2,5-dione
CAS:3-(Octa-2,7-dien-1-yl)dihydrofuran-2,5-dionePurity:97% (stabilized with TBC)Molecular weight:208.26g/mol(2,7-Octadien-1-yl)succinic Anhydride
CAS:2,7-Octadien-1-yl)succinic anhydride is a colorless solid used in the production of polyesters. It is an intermediate in the synthesis of terephthalic acid, which is used to produce polyethylene terephthalate (PET). 2,7-Octadien-1-yl)succinic anhydride can be obtained by reacting ethylene with succinic anhydride. This reaction is catalyzed by a phosphoenolpyruvate carboxykinase that can be found in plants and bacteria. The enzyme is involved in the conversion of phosphoenolpyruvic acid to pyruvate during glycolysis and the metabolism of glucose. The biosynthesis of 2,7-octadien-1-yl)succinic anhydride starts with glutamate and proceeds through two steps: 1) condensation of acetaldehyde and acetyl CoA to form 3-hydroxyFormula:C12H16O3Purity:Min. 95%Molecular weight:208.26 g/mol



