CAS 142852-50-4
:3-(1-benzylpiperidin-4-yl)-1-(2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl)propan-1-one
Description:
3-(1-benzylpiperidin-4-yl)-1-(2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl)propan-1-one, with the CAS number 142852-50-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperidine ring and a benzazepine moiety. This compound typically exhibits properties associated with its functional groups, such as potential psychoactive effects due to its structural similarity to various neurotransmitter modulators. It may possess lipophilic characteristics, allowing it to interact with biological membranes, which can influence its pharmacokinetics and bioavailability. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can affect its solubility and stability in different solvents. Additionally, the compound's stereochemistry may play a significant role in its biological activity, making it a subject of interest in medicinal chemistry and pharmacology. As with many synthetic compounds, safety and toxicity profiles would need to be evaluated through rigorous testing to determine its suitability for any therapeutic applications.
Formula:C25H32N2O
InChI:InChI=1/C25H32N2O/c28-25(23-11-10-22-8-4-5-15-26-24(22)18-23)12-9-20-13-16-27(17-14-20)19-21-6-2-1-3-7-21/h1-3,6-7,10-11,18,20,26H,4-5,8-9,12-17,19H2
SMILES:c1ccc(cc1)CN1CCC(CCC(=O)c2ccc3CCCCNc3c2)CC1
Synonyms:- 1-Propanone, 3-(1-(phenylmethyl)-4-piperidinyl)-1-(2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl)-
- Zanapezil free base
- TAK-147 free base
- ZANAPEZIL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Zanapezil free base
CAS:Zanapezil (TAK-147): potent, selective AChE inhibitor; reversible; IC50=51.2 nM; moderate M1/M2 inhibition; AD research potential.Formula:C25H32N2OColor and Shape:SolidMolecular weight:376.544Zanapezil
CAS:Controlled Product<p>Applications Zanapezil is a acetylcholinesterase inhibitor that is a potential drug for treating Alzheimer disease.<br>References Araujo, J., et al.: Eur. J. Med. Chem., 46, 39 (2010); Jiang, Y., et al.: Curr. Comput. Aided Drug Des., 9, 385 (2013);<br></p>Formula:C25H32N2OColor and Shape:NeatMolecular weight:376.534Zanapezil
CAS:Zanapezil is a human and Chinese analog of mirtazapine that has been studied for its potential anticancer properties. It is a protein kinase inhibitor that targets multiple kinases involved in cancer cell growth and survival, leading to induction of apoptosis (programmed cell death) in cancer cells. Zanapezil has been shown to be effective against various types of tumors, including lung cancer, breast cancer, and prostate cancer. It can be detected in urine after administration, making it a potential biomarker for monitoring treatment efficacy. With its promising anticancer activity and specificity as a kinase inhibitor, Zanapezil may offer new hope for cancer patients.Formula:C25H32N2OPurity:Min. 95%Molecular weight:376.5 g/mol


