CAS 1428532-95-9

3-Pyridinemethanamine, 2-bromo-5-fluoro-, hydrochloride (1:1)

Description:

3-Pyridinemethanamine, 2-bromo-5-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the bromine and fluorine substituents at the 2 and 5 positions, respectively, contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the amine functional group, and its halogen substituents can influence its interaction with biological targets. Additionally, the presence of the hydrochloride indicates that it can form stable complexes with other compounds, which is advantageous in drug formulation. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₆H₆BrFN₂·ClH

InChI: InChI=1S/C6H6BrFN2.ClH/c7-6-4(2-9)1-5(8)3-10-6;/h1,3H,2,9H2;1H

InChI key: InChIKey=NDOWARJQKHJGRY-UHFFFAOYSA-N

SMILES: C(N)C1=C(Br)N=CC(F)=C1.Cl

Synonyms:

• 3-Pyridinemethanamine, 2-bromo-5-fluoro-, hydrochloride (1:1)

(2-Bromo-5-fluoropyridin-3-yl)methanamine hydrochloride

CAS: 1428532-95-9

Formula: C₆H₇BrClFN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 241.4886

Ref: IN-DA00HWPN

(2-Bromo-5-fluoropyridin-3-yl)methanamine hydrochloride

CAS: 1428532-95-9

(2-Bromo-5-fluoropyridin-3-yl)methanamine hydrochloride

Purity: 98%

Molecular weight: 241.49g/mol

Ref: 54-PC100769

(2-Bromo-5-fluoropyridin-3-yl)methanamine hydrochloride

CAS: 1428532-95-9

Purity: 98%

Molecular weight: 241.4900055

Ref: 10-F758760